Difference between revisions of "GALACTOSE-1P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5886 PWY-5886] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5886 PWY-5886] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxyphenylpyruvate biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
| − | + | * [[TYROSINE-AMINOTRANSFERASE-RXN]] | |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Tiso_gene_10680]] | ||
| + | *** [[Tiso_gene_6815]] | ||
| + | *** [[Tiso_gene_17718]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=4-hydroxyphenylpyruvate biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=1}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:30, 21 March 2018
Pathway PWY-5886
- taxonomic range:
- common name:
- 4-hydroxyphenylpyruvate biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- TYROSINE-AMINOTRANSFERASE-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
