Difference between revisions of "AUPT"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10792 == * left end position: ** 3707 * transcription direction: ** POSITIVE * right end position: ** 5834 * centisome position: ** 44.7219...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** α,ω-9Z-octadecenedioate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 310.433 |
* Synonym(s): | * Synonym(s): | ||
| + | ** α,ω-9Z-octadecenedioic acid | ||
| + | ** 1,18-9Z-octadecenedioic acid | ||
| + | ** octadecenedioate | ||
| + | ** 18-carboxyl oleate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16418]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642] |
| − | {{#set: | + | {{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}} |
| − | {{#set: | + | {{#set: common name=α,ω-9Z-octadecenedioate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}} |
| + | {{#set: molecular weight=310.433 }} | ||
| + | {{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}} | ||
| + | {{#set: consumed by=RXN-16418}} | ||
Revision as of 15:30, 21 March 2018
Contents
Metabolite OCTADEC-9-ENE-118-DIOIC-ACID
- smiles:
- C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
- common name:
- α,ω-9Z-octadecenedioate
- inchi key:
- InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
- molecular weight:
- 310.433
- Synonym(s):
- α,ω-9Z-octadecenedioic acid
- 1,18-9Z-octadecenedioic acid
- octadecenedioate
- 18-carboxyl oleate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.
