Difference between revisions of "Tiso gene 20050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N5-Formyl-THF-Glu-N N5-Formyl-THF-Glu-N] == * common name: ** an (6S)-N5-formyl-tetrahydrofolat...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N5-Formyl-THF-Glu-N N5-Formyl-THF-Glu-N] ==
* smiles:
+
** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
* inchi key:
+
** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
+
 
* common name:
 
* common name:
** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
+
** an (6S)-N5-formyl-tetrahydrofolate
* molecular weight:
+
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a folinic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16559]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-6321]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-6341]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an (6S)-N5-formyl-tetrahydrofolate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456]
+
{{#set: common name=a folinic acid}}
{{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: produced by=RXN-6321}}
{{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}}
+
{{#set: reversible reaction associated=RXN-6341}}
{{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}}
+
{{#set: molecular weight=1015.898    }}
+
{{#set: consumed by=RXN-16559}}
+

Revision as of 15:30, 21 March 2018

Metabolite N5-Formyl-THF-Glu-N

  • common name:
    • an (6S)-N5-formyl-tetrahydrofolate
  • Synonym(s):
    • a folinic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links