Difference between revisions of "RXN0-5055"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == * smiles: ** CCCCCC=CCC=CCCCCCCCC([O-])=O * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Tiso_gene_15066 == * right end position: ** 5231 * transcription direction: ** POSITIVE * left end position: ** 134 * centisome position: ** 2.548982...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] ==
+
== Gene Tiso_gene_15066 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CCCCCCCCC([O-])=O
+
** 5231
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OYHQOLUKZRVURQ-HZJYTTRNSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** linoleate
+
** 134
−
* molecular weight:
+
* centisome position:
−
** 279.442    
+
** 2.5489824    
 
* Synonym(s):
 
* Synonym(s):
−
** cis,cis-9,12-octadecadienoate
 
−
** 9-cis,12-cis-octadecadienoate
 
−
** linoleic acid
 
−
** 9,12-linoleic acid
 
−
** (9Z,12Z)-octadeca-9,12-dienoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[LNLCCOAL]]
+
* Reaction: [[3.2.1.21-RXN]]
−
* [[RXN-9673]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
* [[LINOLEOYL-RXN]]
+
** Source: [[annotation-experimental_annotation]]
−
* [[RXN-12776]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-10769]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10773]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13602]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13603]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14179]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5341]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8036]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9674]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-3121]]
 +
* [[PWY-6002]]
 +
* [[PWY-6788]]
 +
* [[PWY-5176]]
 +
* [[PWY-7092]]
 +
* [[PWY-7091]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: right end position=5231}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=281243 281243]
+
{{#set: transcription direction=POSITIVE}}
−
* CAS : 60-33-3
+
{{#set: left end position=134}}
−
* Wikipedia : Linoleic_acid
+
{{#set: centisome position=2.5489824   }}
−
* LIPID_MAPS : LMFA01030120
+
{{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
−
* PUBCHEM:
+
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460332 5460332]
+
−
* HMDB : HMDB00673
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01595 C01595]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573899.html 4573899]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30245 30245]
+
−
* METABOLIGHTS : MTBLC30245
+
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=OYHQOLUKZRVURQ-HZJYTTRNSA-M}}
+
−
{{#set: common name=linoleate}}
+
−
{{#set: molecular weight=279.442   }}
+
−
{{#set: common name=cis,cis-9,12-octadecadienoate|9-cis,12-cis-octadecadienoate|linoleic acid|9,12-linoleic acid|(9Z,12Z)-octadeca-9,12-dienoate}}
+
−
{{#set: consumed by=LNLCCOAL|RXN-9673}}
+
−
{{#set: produced by=LINOLEOYL-RXN|RXN-12776}}
+

Revision as of 15:31, 21 March 2018

Gene Tiso_gene_15066

  • right end position:
    • 5231
  • transcription direction:
    • POSITIVE
  • left end position:
    • 134
  • centisome position:
    • 2.5489824
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-5055&oldid=34591"