Difference between revisions of "ACETYLORNTRANSAM-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13973 == * left end position: ** 3819 * transcription direction: ** POSITIVE * right end position: ** 5693 * centisome position: ** 64.3362...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] == * smiles: ** C(=O)([O-])C(=O)CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C(=O)CC(O)C(O)CO |
− | * | + | * common name: |
− | ** | + | ** 2-dehydro-3-deoxy-D-gluconate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 177.133 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-keto-3-deoxy-D-gluconic acid | ||
+ | ** 2-keto-3-deoxy-D-gluconate | ||
+ | ** 3-deoxy-2-oxo-D-gluconate | ||
+ | ** 2-keto-3-deoxygluconate | ||
+ | ** 3-deoxy-D-erythro-hex-2-ulosonic acid | ||
+ | ** KDG | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[MANNONDEHYDRAT-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 17510-99-5 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229111 44229111] |
− | {{#set: | + | * HMDB : HMDB01353 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00204 C00204] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57990 57990] | ||
+ | * BIGG : 2ddglcn | ||
+ | {{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)CO}} | ||
+ | {{#set: common name=2-dehydro-3-deoxy-D-gluconate}} | ||
+ | {{#set: inchi key=InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M}} | ||
+ | {{#set: molecular weight=177.133 }} | ||
+ | {{#set: common name=2-keto-3-deoxy-D-gluconic acid|2-keto-3-deoxy-D-gluconate|3-deoxy-2-oxo-D-gluconate|2-keto-3-deoxygluconate|3-deoxy-D-erythro-hex-2-ulosonic acid|KDG}} | ||
+ | {{#set: produced by=MANNONDEHYDRAT-RXN}} |
Revision as of 16:32, 21 March 2018
Contents
Metabolite 2-DEHYDRO-3-DEOXY-D-GLUCONATE
- smiles:
- C(=O)([O-])C(=O)CC(O)C(O)CO
- common name:
- 2-dehydro-3-deoxy-D-gluconate
- inchi key:
- InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M
- molecular weight:
- 177.133
- Synonym(s):
- 2-keto-3-deoxy-D-gluconic acid
- 2-keto-3-deoxy-D-gluconate
- 3-deoxy-2-oxo-D-gluconate
- 2-keto-3-deoxygluconate
- 3-deoxy-D-erythro-hex-2-ulosonic acid
- KDG
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CC(O)C(O)CO" cannot be used as a page name in this wiki.