Difference between revisions of "2-3-4-Saturated-L-Phosphatidates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BETA-GLUCURONID-RXN BETA-GLUCURONID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** beta-gl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(6'-me...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BETA-GLUCURONID-RXN BETA-GLUCURONID-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 
* common name:
 
* common name:
−
** beta-glucuronidase
+
** 3-(6'-methylthio)hexylmalate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.2.1.31 EC-3.2.1.31]
+
** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 262.32   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(6'-methylthio)hexylmalic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXNQT-4174]]
−
** 1 [[Beta-D-Glucuronides]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[D-Glucopyranuronate]][c] '''+''' 1 [[Alcohols]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a β-D-glucuronoside[c] '''+''' 1 H2O[c] '''=>''' 1 D-glucopyranuronate[c] '''+''' 1 an alcohol[c]
+
* [[RXN-18202]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13087]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-7247]], β-D-glucuronide and D-glucuronate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7247 PWY-7247]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01478 R01478]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339]
−
* UNIPROT:
+
{{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
−
** [http://www.uniprot.org/uniprot/P06760 P06760]
+
{{#set: common name=3-(6'-methylthio)hexylmalate}}
−
** [http://www.uniprot.org/uniprot/P08236 P08236]
+
{{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}}
−
** [http://www.uniprot.org/uniprot/P12265 P12265]
+
{{#set: molecular weight=262.32    }}
−
** [http://www.uniprot.org/uniprot/P05804 P05804]
+
{{#set: common name=3-(6'-methylthio)hexylmalic acid}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: consumed by=RXNQT-4174}}
−
{{#set: common name=beta-glucuronidase}}
+
{{#set: reversible reaction associated=RXN-18202}}
−
{{#set: ec number=EC-3.2.1.31}}
+
−
{{#set: gene associated=Tiso_gene_13087}}
+
−
{{#set: in pathway=PWY-7247}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 15:33, 21 March 2018

Metabolite CPDQT-39

  • smiles:
    • CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • common name:
    • 3-(6'-methylthio)hexylmalate
  • inchi key:
    • InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
  • molecular weight:
    • 262.32
  • Synonym(s):
    • 3-(6'-methylthio)hexylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-3-4-Saturated-L-Phosphatidates&oldid=34764"