Difference between revisions of "Tiso gene 16197"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.17.11-RXN 3.4.17.11-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Glutamate carboxype...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.17.11-RXN 3.4.17.11-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Glutamate carboxypeptidase 2 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.4.17.11 EC-3.4.17.11] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-12826]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PTEROATE]][c] '''+''' 1 [[Glutamates]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 folate[c] '''+''' 1 H2O[c] '''=>''' 1 pteroate[c] '''+''' 1 a glutamate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_5253]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Glutamate carboxypeptidase 2}} | |
− | + | {{#set: ec number=EC-3.4.17.11}} | |
− | + | {{#set: gene associated=Tiso_gene_5253}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:33, 21 March 2018
Contents
Reaction 3.4.17.11-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Glutamate carboxypeptidase 2
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-12826[c] + 1 WATER[c] => 1 PTEROATE[c] + 1 Glutamates[c]
- With common name(s):
- 1 folate[c] + 1 H2O[c] => 1 pteroate[c] + 1 a glutamate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5253
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation