Difference between revisions of "RXN-16648"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNURONATE-REDUCTASE-RXN MANNURONATE-REDUCTASE-RXN] == * direction: ** REVERSIBLE * common name: *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNURONATE-REDUCTASE-RXN MANNURONATE-REDUCTASE-RXN] == |
| − | + | * direction: | |
| − | + | ** REVERSIBLE | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** carbonyl_reductase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.131 EC-1.1.1.131] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[D-MANNONATE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''<=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[D-mannuronates]][c] '''+''' 1 [[PROTON]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 D-mannonate[c] '''+''' 1 NAD(P)+[c] '''<=>''' 1 NAD(P)H[c] '''+''' 1 D-mannuronate[c] '''+''' 1 H+[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_20417]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10639 10639] |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10635 10635] | |
| − | ** [http://www.ebi.ac.uk/ | + | * LIGAND-RXN: |
| − | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02456 R02456] |
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | ** [http:// | + | {{#set: common name=carbonyl_reductase}} |
| − | + | {{#set: ec number=EC-1.1.1.131}} | |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_20417}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
Revision as of 15:34, 21 March 2018
Contents
Reaction MANNURONATE-REDUCTASE-RXN
- direction:
- REVERSIBLE
- common name:
- carbonyl_reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 D-MANNONATE[c] + 1 NAD-P-OR-NOP[c] <=> 1 NADH-P-OR-NOP[c] + 1 D-mannuronates[c] + 1 PROTON[c]
- With common name(s):
- 1 D-mannonate[c] + 1 NAD(P)+[c] <=> 1 NAD(P)H[c] + 1 D-mannuronate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_20417
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
