Difference between revisions of "NICOTINAMIDE-N-METHYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3498 == * left end position: ** 61 * transcription direction: ** POSITIVE * right end position: ** 5306 * centisome position: ** 0.16895635...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * common name: |
− | ** | + | ** teasterone |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 448.685 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-717]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-716]] | |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13475125 13475125] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=26863 26863] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15791 C15791] | ||
+ | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: common name=teasterone}} | ||
+ | {{#set: inchi key=InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N}} | ||
+ | {{#set: molecular weight=448.685 }} | ||
+ | {{#set: consumed by=RXN-717}} | ||
+ | {{#set: produced by=RXN-716}} |
Revision as of 15:34, 21 March 2018
Contents
Metabolite CPD-716
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- teasterone
- inchi key:
- InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N
- molecular weight:
- 448.685
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.