Difference between revisions of "NICOTINAMIDE-N-METHYLTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_3498 == * left end position: ** 61 * transcription direction: ** POSITIVE * right end position: ** 5306 * centisome position: ** 0.16895635...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_3498 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] ==
* left end position:
+
* smiles:
** 61
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* common name:
** POSITIVE
+
** teasterone
* right end position:
+
* inchi key:
** 5306
+
** InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N
* centisome position:
+
* molecular weight:
** 0.16895635    
+
** 448.685    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[DNA-LIGASE-ATP-RXN]]
+
* [[RXN-717]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-716]]
* [[RXN-17917]]
+
== Reaction(s) of unknown directionality ==
** in-silico_annotation
+
***ec-number
+
* [[RXN-17918]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-17919]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=61}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13475125 13475125]
{{#set: right end position=5306}}
+
* CHEBI:
{{#set: centisome position=0.16895635   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=26863 26863]
{{#set: reaction associated=DNA-LIGASE-ATP-RXN|RXN-17917|RXN-17918|RXN-17919}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15791 C15791]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=teasterone}}
 +
{{#set: inchi key=InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N}}
 +
{{#set: molecular weight=448.685   }}
 +
{{#set: consumed by=RXN-717}}
 +
{{#set: produced by=RXN-716}}

Revision as of 15:34, 21 March 2018

Metabolite CPD-716

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • teasterone
  • inchi key:
    • InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N
  • molecular weight:
    • 448.685
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.