Difference between revisions of "Tiso gene 1810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15368 CPD-15368] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_15500 == * Synonym(s): == Reactions associated == * Reaction: RXN0-5462 ** Source: orthology-esiliculosus == Pathways associated =...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15368 CPD-15368] ==
+
== Gene Tiso_gene_15500 ==
* smiles:
+
** CCCCCCC(O)CC=CCCCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
* inchi key:
+
** InChIKey=NQXRRZBOZBKGIU-MHAUFEDZSA-J
+
* common name:
+
** 3-oxo-lesqueroloyl-CoA
+
* molecular weight:
+
** 1085.989   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14493]]
+
* Reaction: [[RXN0-5462]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN0-5462}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657339 90657339]
+
{{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: inchi key=InChIKey=NQXRRZBOZBKGIU-MHAUFEDZSA-J}}
+
{{#set: common name=3-oxo-lesqueroloyl-CoA}}
+
{{#set: molecular weight=1085.989    }}
+
{{#set: consumed by=RXN-14493}}
+

Revision as of 15:34, 21 March 2018

Gene Tiso_gene_15500

  • Synonym(s):

Reactions associated

Pathways associated

External links