Difference between revisions of "TRP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17449 == * left end position: ** 150 * transcription direction: ** POSITIVE * right end position: ** 3594 * centisome position: ** 4.060639...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
+
== Gene Tiso_gene_17449 ==
−
* smiles:
+
* left end position:
−
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
+
** 150
−
* inchi key:
+
* transcription direction:
−
** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 1D-myo-inositol 6-monophosphate
+
** 3594
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 4.060639    
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(6)P1
 
−
** 1D-myo-inositol 6-phosphate
 
−
** Ins(6)P
 
−
** Ins6P
 
−
** D-myo-inositol 6-monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10954]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12195]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12196]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN0-5462]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=150}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3594}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841]
+
{{#set: centisome position=4.060639   }}
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}}
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: common name=1D-myo-inositol 6-monophosphate}}
+
−
{{#set: molecular weight=258.121   }}
+
−
{{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}}
+
−
{{#set: consumed by=RXN-10954}}
+

Revision as of 16:14, 10 January 2018

Gene Tiso_gene_17449

  • left end position:
    • 150
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3594
  • centisome position:
    • 4.060639
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRP&oldid=12046"