Difference between revisions of "Tiso gene 5715"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526] == * direction: ** LEFT-TO-RIGHT * common name: ** trans oct-2-enoyl-[acyl-carri...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)
 
* common name:
 
* common name:
−
** trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
+
** (S)-equol 4'-sulfate
−
** polyketide_synthase
+
* inchi key:
−
* ec number:
+
** InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M
−
** [http://enzyme.expasy.org/EC/1.3.1.10 EC-1.3.1.10]
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.39 EC-1.3.1.39]
+
** 321.324   
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
 
* Synonym(s):
 
* Synonym(s):
−
** trans oct-2-enoyl-ACP reductase
+
** 4',7-isoflavandiol 4'-sulfate
−
** trans oct-2-enoyl acyl-carrier-protein reductase
+
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[2-Octenoyl-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Octanoyl-ACPs]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-15589]]
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a trans oct-2-enoyl-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 an octanoyl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_136]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_10876]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_500]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_135]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_13394]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29979373 29979373]
−
{{#set: common name=polyketide_synthase}}
+
{{#set: smiles=C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)}}
−
{{#set: ec number=EC-1.3.1.10}}
+
{{#set: common name=(S)-equol 4'-sulfate}}
−
{{#set: ec number=EC-1.3.1.39}}
+
{{#set: inchi key=InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M}}
−
{{#set: ec number=EC-2.3.1.85}}
+
{{#set: molecular weight=321.324    }}
−
{{#set: ec number=EC-2.3.1.86}}
+
{{#set: common name=4',7-isoflavandiol 4'-sulfate}}
−
{{#set: common name=trans oct-2-enoyl-ACP reductase|trans oct-2-enoyl acyl-carrier-protein reductase}}
+
{{#set: reversible reaction associated=RXN-15589}}
−
{{#set: gene associated=Tiso_gene_136|Tiso_gene_10876|Tiso_gene_500|Tiso_gene_135|Tiso_gene_13394}}
+
−
{{#set: in pathway=PWY-5994}}
+
−
{{#set: reconstruction category=manual|annotation}}
+
−
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 15:36, 21 March 2018

Metabolite CPD-16825

  • smiles:
    • C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)
  • common name:
    • (S)-equol 4'-sulfate
  • inchi key:
    • InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M
  • molecular weight:
    • 321.324
  • Synonym(s):
    • 4',7-isoflavandiol 4'-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5715&oldid=35153"