Difference between revisions of "Tiso gene 15839"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_412 == * Synonym(s): == Reactions associated == * RXN-1224 ** pantograph-esiliculosus * RXN-15117 ** pantograph-atha...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_412 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] ==
 +
* smiles:
 +
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
 +
* common name:
 +
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
 +
* inchi key:
 +
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
 +
* molecular weight:
 +
** 414.713   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-1224]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN66-14]]
* [[RXN-15117]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[athaliana]]
+
== Pathways associated ==
+
* [[PWY-7817]]
+
* [[PWYQT-4427]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-1224|RXN-15117}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7817|PWYQT-4427}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091]
 +
* HMDB : HMDB06840
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915]
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
 +
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}}
 +
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}}
 +
{{#set: molecular weight=414.713    }}
 +
{{#set: produced by=RXN66-14}}

Revision as of 15:36, 21 March 2018

Metabolite CPD-8610

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • common name:
    • 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
  • inchi key:
    • InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
  • molecular weight:
    • 414.713
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.