Difference between revisions of "TRANS-D2-ENOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_7561 == * left end position: ** 1767 * transcription direction: ** POSITIVE * right end position: ** 11030 * centisome position: ** 16.0170...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_7561 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
−
* left end position:
+
* smiles:
−
** 1767
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
−
* right end position:
+
* common name:
−
** 11030
+
** phytenate
−
* centisome position:
+
* molecular weight:
−
** 16.01704    
+
** 309.511    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E-phytenate
 +
** 2E-phytenic acid
 +
** 3,7,11,15-tetramethyl-2E-hexadecenoic acid
 +
** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.1.4.11-RXN]]
+
* [[RXN66-480]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN66-479]]
−
* [[RXN-13334]]
+
== Reaction(s) of unknown directionality ==
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-16261]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-6367]]
+
−
* [[PWY-6351]]
+
−
* [[PWY-7039]]
+
−
* [[LIPASYN-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1767}}
+
* LIPID_MAPS : LMPR0104010024
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=11030}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589]
−
{{#set: centisome position=16.01704   }}
+
* CHEMSPIDER:
−
{{#set: reaction associated=3.1.4.11-RXN|RXN-13334|RXN-16261}}
+
** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755]
−
{{#set: pathway associated=PWY-6367|PWY-6351|PWY-7039|LIPASYN-PWY}}
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}}
 +
{{#set: common name=phytenate}}
 +
{{#set: molecular weight=309.511   }}
 +
{{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}}
 +
{{#set: consumed by=RXN66-480}}
 +
{{#set: produced by=RXN66-479}}

Revision as of 16:14, 10 January 2018

Metabolite CPD-14927

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
  • inchi key:
    • InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
  • common name:
    • phytenate
  • molecular weight:
    • 309.511
  • Synonym(s):
    • 2E-phytenate
    • 2E-phytenic acid
    • 3,7,11,15-tetramethyl-2E-hexadecenoic acid
    • (E)-3,7,11,15-tetramethylhexadec-2-enoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRANS-D2-ENOYL-COA&oldid=12049"