Difference between revisions of "Holo-VibB"

Revision as of 15:37, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] ==
+== Gene Tiso_gene_12496 ==
-* smiles:
+* right end position:
-** C(O)C(C(=O)N[R])NC(=O)[R]
+** 4124
-* common name:
+* transcription direction:
-** myosin light-chain
+** NEGATIVE
+* left end position:
+** 27
+* centisome position:
+** 0.38888088
 * Synonym(s):
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-== Reaction(s) known to produce the compound ==
+* Reaction: [[ISOLEUCINE--TRNA-LIGASE-RXN]]
-== Reaction(s) of unknown directionality ==
+** Source: [[annotation-in-silico_annotation]]
-* [[2.7.11.18-RXN]]
+*** Assignment: ec-number
+** Source: [[annotation-experimental_annotation]]
+*** Assignment: ec-number
+** Source: [[orthology-esiliculosus]]
+== Pathways associated ==
+* [[TRNA-CHARGING-PWY]]
 == External links  ==
-* LIGAND-CPD:
+{{#set: right end position=4124}}
-** [http://www.genome.jp/dbget-bin/www_bget?C01003 C01003]
+{{#set: transcription direction=NEGATIVE}}
-{{#set: smiles=C(O)C(C(=O)N[R])NC(=O)[R]}}
+{{#set: left end position=27}}
-{{#set: common name=myosin light-chain}}
+{{#set: centisome position=0.38888088    }}
-{{#set: reversible reaction associated=2.7.11.18-RXN}}
+{{#set: reaction associated=ISOLEUCINE--TRNA-LIGASE-RXN}}
+{{#set: pathway associated=TRNA-CHARGING-PWY}}