Difference between revisions of "RXN-14229"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-27 RXN66-27] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-27 RXN66-27] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.3.1.21 EC-1.3.1.21] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[CPD-8646]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[DESMOSTEROL-CPD]][c] '''+''' 1 [[NADP]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 7-dehydrodesmosterol[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 desmosterol[c] '''+''' 1 NADP+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_8982]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] | ||
| + | ** '''7''' reactions found over '''22''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.3.1.21}} | |
| − | + | {{#set: gene associated=Tiso_gene_8982}} | |
| − | + | {{#set: in pathway=PWY66-4}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:39, 21 March 2018
Contents
Reaction RXN66-27
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-8646[c] + 1 NADPH[c] + 1 PROTON[c] => 1 DESMOSTEROL-CPD[c] + 1 NADP[c]
- With common name(s):
- 1 7-dehydrodesmosterol[c] + 1 NADPH[c] + 1 H+[c] => 1 desmosterol[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_8982
- Source: orthology-esiliculosus
Pathways
- PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
- 7 reactions found over 22 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
