Difference between revisions of "GLYNA1tm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Co-Chaperones FeS-Cluster-Co-Chaperones] == * common name: ** an [Fe-S cluster bios...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Co-Chaperones FeS-Cluster-Co-Chaperones] ==
* smiles:
+
** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))
+
* inchi key:
+
** InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N
+
 
* common name:
 
* common name:
** cotinine
+
** an [Fe-S cluster biosynthesis co-chaperone]
* molecular weight:
+
** 176.218   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-169]]
+
* [[RXN-14388]]
* [[RXN66-161]]
+
* [[RXN66-168]]
+
* [[RXN66-163]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14390]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an [Fe-S cluster biosynthesis co-chaperone]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=854019 854019]
+
{{#set: consumed by=RXN-14388}}
* CHEMSPIDER:
+
{{#set: produced by=RXN-14390}}
** [http://www.chemspider.com/Chemical-Structure.746405.html 746405]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68641 68641]
+
* METABOLIGHTS : MTBLC68641
+
* HMDB : HMDB01046
+
{{#set: smiles=C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))}}
+
{{#set: inchi key=InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N}}
+
{{#set: common name=cotinine}}
+
{{#set: molecular weight=176.218    }}
+
{{#set: consumed by=RXN66-169|RXN66-161|RXN66-168|RXN66-163}}
+

Revision as of 15:40, 21 March 2018

Metabolite FeS-Cluster-Co-Chaperones

  • common name:
    • an [Fe-S cluster biosynthesis co-chaperone]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [Fe-S cluster biosynthesis co-chaperone" cannot be used as a page name in this wiki.