Difference between revisions of "Tiso gene 8272"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_13815 == * right end position: ** 5366 * transcription direction: ** POSITIVE * left end position: ** 4148 * centisome position: ** 68.6300...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] ==
+
== Gene Tiso_gene_13815 ==
−
* smiles:
+
* right end position:
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
+
** 5366
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** α,α-trehalose 6-phosphate
+
** 4148
−
* molecular weight:
+
* centisome position:
−
** 420.263    
+
** 68.63004    
 
* Synonym(s):
 
* Synonym(s):
−
** α,α-D-trehalose 6-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[TREHALOSEPHOSPHA-RXN]]
+
* Reaction: [[RXN-17155]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[UG6PGT]]
+
*** Assignment: automated-name-match
−
* [[UG6PGTn]]
+
== Pathways associated ==
−
* [[TREHALOSE6PSYN-RXN]]
+
* [[PWY-7735]]
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* CAS : 4484-88-2
+
{{#set: right end position=5366}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105]
+
{{#set: left end position=4148}}
−
* HMDB : HMDB01124
+
{{#set: centisome position=68.63004   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-17155}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689]
+
{{#set: pathway associated=PWY-7735}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429]
+
−
* BIGG : tre6p
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}}
+
−
{{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}}
+
−
{{#set: common name=α,α-trehalose 6-phosphate}}
+
−
{{#set: molecular weight=420.263   }}
+
−
{{#set: common name=α,α-D-trehalose 6-phosphate}}
+
−
{{#set: consumed by=TREHALOSEPHOSPHA-RXN}}
+
−
{{#set: produced by=UG6PGT|UG6PGTn|TREHALOSE6PSYN-RXN}}
+

Revision as of 15:40, 21 March 2018

Gene Tiso_gene_13815

  • right end position:
    • 5366
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4148
  • centisome position:
    • 68.63004
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8272&oldid=35500"