Difference between revisions of "Tiso gene 6144"

Revision as of 15:40, 21 March 2018

"CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine13 tRNA-uridine13] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
+* smiles:
+** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
 * common name:
-** a uridine13 in tRNA
+** 4-hydroxy-2-nonenal-glutathione conjugate
+* inchi key:
+** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
+* molecular weight:
+** 462.537
 * Synonym(s):
-** a tRNA uridine13
 == Reaction(s) known to consume the compound ==
-* [[RXN-11841]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-13673]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a uridine13 in tRNA}}
+* PUBCHEM:
-{{#set: common name=a tRNA uridine13}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
-{{#set: consumed by=RXN-11841}}
+{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
+{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
+{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
+{{#set: molecular weight=462.537    }}
+{{#set: produced by=RXN-13673}}