Difference between revisions of "ADP-SUGARS"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Gene == Gene Tiso_gene_10131 == * right end position: ** 8289 * transcription direction: ** POSITIVE * left end position: ** 2777 * centisome position: ** 31.6071...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Gene Tiso_gene_10131 ==
* smiles:
+
* right end position:
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 8289
* inchi key:
+
* transcription direction:
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
+
** POSITIVE
* common name:
+
* left end position:
** 3-oxo-(5Z)-dodecenoyl-CoA
+
** 2777
* molecular weight:
+
* centisome position:
** 957.775    
+
** 31.607103    
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-12:1-Δ5-CoA
 
** 3-oxo-5-cis-dodecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17799]]
+
* Reaction: [[3.1.26.3-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-17798]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=8289}}
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
+
{{#set: left end position=2777}}
{{#set: molecular weight=957.775   }}
+
{{#set: centisome position=31.607103   }}
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
+
{{#set: reaction associated=3.1.26.3-RXN}}
{{#set: consumed by=RXN-17799}}
+
{{#set: produced by=RXN-17798}}
+

Revision as of 15:41, 21 March 2018

Gene Tiso_gene_10131

  • right end position:
    • 8289
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2777
  • centisome position:
    • 31.607103
  • Synonym(s):

Reactions associated

Pathways associated

External links