Difference between revisions of "RXN-17881"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
(Created page with "Category:Gene == Gene Tiso_gene_7740 == * right end position: ** 8387 * transcription direction: ** POSITIVE * left end position: ** 6346 * centisome position: ** 58.41848...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7740 == |
− | * | + | * right end position: |
− | ** | + | ** 8387 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 6346 |
− | * | + | * centisome position: |
− | ** | + | ** 58.418484 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[LIGNOSTILBENE-ALPHA-BETA-DIOXYGENASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-11989]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-11999]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-13374]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-698]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-7973]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-7974]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6681]] | ||
+ | * [[PWY-695]] | ||
+ | * [[PWY-6857]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8387}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=6346}} |
− | {{#set: | + | {{#set: centisome position=58.418484 }} |
− | {{#set: | + | {{#set: reaction associated=LIGNOSTILBENE-ALPHA-BETA-DIOXYGENASE-RXN|RXN-11989|RXN-11999|RXN-13374|RXN-698|RXN-7973|RXN-7974}} |
− | {{#set: | + | {{#set: pathway associated=PWY-6681|PWY-695|PWY-6857}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:41, 21 March 2018
Gene Tiso_gene_7740
- right end position:
- 8387
- transcription direction:
- POSITIVE
- left end position:
- 6346
- centisome position:
- 58.418484
- Synonym(s):
Reactions associated
- Reaction: LIGNOSTILBENE-ALPHA-BETA-DIOXYGENASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-11989
- Source: orthology-esiliculosus
- Reaction: RXN-11999
- Source: orthology-esiliculosus
- Reaction: RXN-13374
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-698
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-7973
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-7974
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation