Difference between revisions of "RXN-17881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...")
(Created page with "Category:Gene == Gene Tiso_gene_7740 == * right end position: ** 8387 * transcription direction: ** POSITIVE * left end position: ** 6346 * centisome position: ** 58.41848...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
+
== Gene Tiso_gene_7740 ==
−
* smiles:
+
* right end position:
−
** C(=O)(C1(O)(C=CCCC(=O)1))[O-]
+
** 8387
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 6-hydroxy-2-cyclohexen-one-carboxylate
+
** 6346
−
* molecular weight:
+
* centisome position:
−
** 155.13    
+
** 58.418484    
 
* Synonym(s):
 
* Synonym(s):
−
** 6-hydroxy-2-cyclohexen-one-carboxylic acid
 
−
** HCC
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[LIGNOSTILBENE-ALPHA-BETA-DIOXYGENASE-RXN]]
−
* [[RXN-12252]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-11989]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-11999]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13374]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-698]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7973]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7974]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6681]]
 +
* [[PWY-695]]
 +
* [[PWY-6857]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=8387}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}}
+
{{#set: left end position=6346}}
−
{{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}}
+
{{#set: centisome position=58.418484   }}
−
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}}
+
{{#set: reaction associated=LIGNOSTILBENE-ALPHA-BETA-DIOXYGENASE-RXN|RXN-11989|RXN-11999|RXN-13374|RXN-698|RXN-7973|RXN-7974}}
−
{{#set: molecular weight=155.13   }}
+
{{#set: pathway associated=PWY-6681|PWY-695|PWY-6857}}
−
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}}
+
−
{{#set: produced by=RXN-12252}}
+

Revision as of 15:41, 21 March 2018

Gene Tiso_gene_7740

  • right end position:
    • 8387
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6346
  • centisome position:
    • 58.418484
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17881&oldid=35668"