Difference between revisions of "Tiso gene 2100"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)[N+])[N+] * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_15145 == * right end position: ** 4970 * transcription direction: ** POSITIVE * left end position: ** 622 * centisome position: ** 11.94545...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15145 == |
− | * | + | * right end position: |
− | ** | + | ** 4970 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 622 |
− | * | + | * centisome position: |
− | ** | + | ** 11.945457 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PYRUVATE-CARBOXYLASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-6142]] | ||
+ | * [[PWY-6146]] | ||
+ | * [[P42-PWY]] | ||
+ | * [[PWY-5750]] | ||
+ | * [[PWY66-399]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4970}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=622}} | |
− | + | {{#set: centisome position=11.945457 }} | |
− | + | {{#set: reaction associated=PYRUVATE-CARBOXYLASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-6142|PWY-6146|P42-PWY|PWY-5750|PWY66-399}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:41, 21 March 2018
Gene Tiso_gene_15145
- right end position:
- 4970
- transcription direction:
- POSITIVE
- left end position:
- 622
- centisome position:
- 11.945457
- Synonym(s):
Reactions associated
- Reaction: PYRUVATE-CARBOXYLASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation