Difference between revisions of "Tiso gene 4269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] == * direction: ** LEFT-TO-RIGHT * common name: ** cystathionine beta-lyase *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] ==
−
* smiles:
+
* direction:
−
** C(O)C(=O)C(O)C(O)C(O)CO
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N
+
 
* common name:
 
* common name:
−
** keto-D-fructose
+
** cystathionine beta-lyase
−
* molecular weight:
+
−
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14515]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[L-CYSTATHIONINE]][c] '''=>''' 1 [[HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[2-AMINOACRYLATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-7644]]
+
** 1 L-cystathionine[c] '''=>''' 1 L-homocysteine[c] '''+''' 1 H+[c] '''+''' 1 2-aminoprop-2-enoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3732]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[HOMOSER-METSYN-PWY]], L-methionine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-801]], L-homocysteine and L-cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5984 5984]
+
{{#set: common name=cystathionine beta-lyase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3732}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48095 48095]
+
{{#set: in pathway=HOMOSER-METSYN-PWY|PWY-801|PWY-702}}
−
* METABOLIGHTS : MTBLC48095
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
−
{{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=keto-D-fructose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: consumed by=RXN-14515}}
+
−
{{#set: reversible reaction associated=RXN-7644}}
+

Revision as of 15:42, 21 March 2018

Reaction RXN-15131

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cystathionine beta-lyase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • HOMOSER-METSYN-PWY, L-methionine biosynthesis I: HOMOSER-METSYN-PWY
    • 4 reactions found over 5 reactions in the full pathway
  • PWY-801, L-homocysteine and L-cysteine interconversion: PWY-801
    • 3 reactions found over 3 reactions in the full pathway
  • PWY-702, L-methionine biosynthesis II: PWY-702
    • 5 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4269&oldid=35705"