Difference between revisions of "GALACTOSYLCERAMIDE-SULFATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01220 R01220] == * direction: ** REVERSIBLE * common name: ** R146 * Synonym(s): == Reaction Form...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01220 R01220] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
 
* common name:
 
* common name:
−
** R146
+
** 1-18:1-2-18:1-phosphatidylethanolamine
 +
* inchi key:
 +
** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
 +
* molecular weight:
 +
** 744.043   
 
* Synonym(s):
 
* Synonym(s):
 +
** phosphatidylethanolamine (1-18:1-2-18:1)
 +
** 18:1-18:1-PE
 +
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15067]]
−
** 1.0 [[NADP]][c] '''+''' 1.0 [[METHYLENE-THF]][c] '''<=>''' 1.0 [[5-10-METHENYL-THF]][c] '''+''' 1.0 [[NADPH]][c]
+
* [[PE1819Z1819Zt]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1.0 NADP+[c] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] '''<=>''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] '''+''' 1.0 NADPH[c]
+
* [[PE1819Z1819Zt]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
* [[RXN-15036]]
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_432]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=R146}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425]
−
{{#set: gene associated=Tiso_gene_432}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}}
−
{{#set: reconstruction source=orthology-synechocystis}}
+
{{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}}
 +
{{#set: molecular weight=744.043    }}
 +
{{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
 +
{{#set: consumed by=RXN-15067|PE1819Z1819Zt}}
 +
{{#set: produced by=PE1819Z1819Zt}}
 +
{{#set: reversible reaction associated=RXN-15036}}

Revision as of 15:42, 21 March 2018

Metabolite CPD-8291

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
  • common name:
    • 1-18:1-2-18:1-phosphatidylethanolamine
  • inchi key:
    • InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
  • molecular weight:
    • 744.043
  • Synonym(s):
    • phosphatidylethanolamine (1-18:1-2-18:1)
    • 18:1-18:1-PE
    • 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GALACTOSYLCERAMIDE-SULFATE&oldid=35720"