Difference between revisions of "3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17860 RXN-17860] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * smiles: ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17860 RXN-17860] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.3.1.bu EC-2.3.1.bu]
+
** mycophenolic acid O-acyl-glucuronide
 +
* inchi key:
 +
** InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
 +
* molecular weight:
 +
** 495.459   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ACETYL-COA]][c] '''+''' 1 [[N-terminal-L-alanine]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[N-terminal-N-Ac-L-alanine]][c]
+
* [[RXN-13607]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 acetyl-CoA[c] '''+''' 1 an N-terminal L-alanyl-[protein][c] '''=>''' 1 H+[c] '''+''' 1 coenzyme A[c] '''+''' 1 an N-terminal Nα-acetyl-L-alanyl-[protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
+
−
** '''21''' reactions found over '''21''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.1.bu}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678773 70678773]
−
{{#set: in pathway=PWY-7800}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66982 66982]
−
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
+
{{#set: smiles=CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=mycophenolic acid O-acyl-glucuronide}}
 +
{{#set: inchi key=InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M}}
 +
{{#set: molecular weight=495.459    }}
 +
{{#set: produced by=RXN-13607}}

Revision as of 15:42, 21 March 2018

Metabolite CPD-14602

  • smiles:
    • CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
  • common name:
    • mycophenolic acid O-acyl-glucuronide
  • inchi key:
    • InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
  • molecular weight:
    • 495.459
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN&oldid=35761"