Difference between revisions of "Tiso gene 210"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SERINE D-SERINE] == * smiles: ** C(O)C([N+])C([O-])=O * inchi key: ** InChIKey=MTCFGRXMJLQNBG...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7263 CPD-7263] == * common name: ** a α-D-mannosyl-(1->6)-β-D-mannosyl-(1->4)-N-...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SERINE D-SERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7263 CPD-7263] ==
* smiles:
+
** C(O)C([N+])C([O-])=O
+
* inchi key:
+
** InChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N
+
 
* common name:
 
* common name:
** D-serine
+
** a α-D-mannosyl-(1->6)-β-D-mannosyl-(1->4)-N-acetyl-β-D-glucosaminyl-(1->4)-N-acetyl-β-D-glucosaminyl-[glycoprotein]
* molecular weight:
+
** 105.093   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.2.1.152-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5.1.1.18-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 312-84-5
+
{{#set: common name=a α-D-mannosyl-(1->6)-β-D-mannosyl-(1->4)-N-acetyl-β-D-glucosaminyl-(1->4)-N-acetyl-β-D-glucosaminyl-[glycoprotein]}}
* METABOLIGHTS : MTBLC35247
+
{{#set: consumed by=3.2.1.152-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857549 6857549]
+
* HMDB : HMDB03406
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00740 C00740]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35247 35247]
+
* BIGG : ser__D
+
{{#set: smiles=C(O)C([N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N}}
+
{{#set: common name=D-serine}}
+
{{#set: molecular weight=105.093    }}
+
{{#set: produced by=5.1.1.18-RXN}}
+

Revision as of 15:42, 21 March 2018

Metabolite CPD-7263

  • common name:
    • a α-D-mannosyl-(1->6)-β-D-mannosyl-(1->4)-N-acetyl-β-D-glucosaminyl-(1->4)-N-acetyl-β-D-glucosaminyl-[glycoprotein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a α-D-mannosyl-(1->6)-β-D-mannosyl-(1->4)-N-acetyl-β-D-glucosaminyl-(1->4)-N-acetyl-β-D-glucosaminyl-[glycoprotein" cannot be used as a page name in this wiki.