Difference between revisions of "RXN-5821"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6069 == * left end position: ** 148 * transcription direction: ** NEGATIVE * right end position: ** 2554 * centisome position: ** 1.1740441...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * common name: ** keto-D-fructose...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
| − | * | + | * common name: |
| − | ** | + | ** keto-D-fructose |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14515]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-7644]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5984 5984] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48095 48095] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC48095 |
| − | {{#set: | + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} |
| + | {{#set: common name=keto-D-fructose}} | ||
| + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N}} | ||
| + | {{#set: molecular weight=180.157 }} | ||
| + | {{#set: consumed by=RXN-14515}} | ||
| + | {{#set: reversible reaction associated=RXN-7644}} | ||
Revision as of 15:42, 21 March 2018
Contents
Metabolite CPD-15382
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- common name:
- keto-D-fructose
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
