Difference between revisions of "Tiso gene 11842"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LAUROYLCOA-CPD LAUROYLCOA-CPD] == * smiles: ** CCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * common name...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine |
+ | * inchi key: | ||
+ | ** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 298.374 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP |
− | ** | + | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione |
− | ** | + | ** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine |
+ | ** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP | ||
+ | ** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15684]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023] |
− | + | {{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}} | |
− | + | {{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}} | |
− | + | {{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}} | |
− | + | {{#set: molecular weight=298.374 }} | |
− | + | {{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}} | |
− | + | {{#set: consumed by=RXN-15684}} | |
− | {{#set: smiles= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 15:42, 21 March 2018
Contents
Metabolite CPD-17049
- smiles:
- C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
- common name:
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
- inchi key:
- InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
- molecular weight:
- 298.374
- Synonym(s):
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: