Difference between revisions of "R95"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17892 RXN-17892] == * direction: ** LEFT-TO-RIGHT * common name: ** acylamino-acid-releasing_en...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17892 RXN-17892] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
+
 
* common name:
 
* common name:
** dIDP
+
** acylamino-acid-releasing_enzyme
* molecular weight:
+
* ec number:
** 409.165   
+
** [http://enzyme.expasy.org/EC/3.4.19.1 EC-3.4.19.1]
 
* Synonym(s):
 
* Synonym(s):
** deoxyinosine diphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[WATER]][c] '''+''' 1 [[N-Ac-L-methionyl-L-asparaginyl-Protein]][c] '''=>''' 1 [[CPD0-2015]][c] '''+''' 1 [[N-terminal-asparagine]][c]
* [[RXN-14228]]
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 an N-terminal-Nα-acetyl-L-methionyl-L-asparaginyl-[protein][c] '''=>''' 1 Nα-acetyl-L-methionine[c] '''+''' 1 an N-terminal asparaginyl-[protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3550]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799]
 +
** '''8''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
+
{{#set: common name=acylamino-acid-releasing_enzyme}}
* CHEBI:
+
{{#set: ec number=EC-3.4.19.1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
+
{{#set: gene associated=Tiso_gene_3550}}
* BIGG : didp
+
{{#set: in pathway=PWY-7799}}
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
* HMDB : HMDB03536
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
+
{{#set: common name=dIDP}}
+
{{#set: molecular weight=409.165    }}
+
{{#set: common name=deoxyinosine diphosphate}}
+
{{#set: reversible reaction associated=RXN-14228}}
+

Revision as of 15:42, 21 March 2018

Reaction RXN-17892

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acylamino-acid-releasing_enzyme
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7799, Arg/N-end rule pathway (eukaryotic): PWY-7799
    • 8 reactions found over 14 reactions in the full pathway

Reconstruction information

External links