Difference between revisions of "TRNA-pseudouridine13"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nitriles Nitriles] == * common name: ** a nitrile * Synonym(s): ** nitrile ** R-CN ** a nitrile...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] == * smiles: ** C(=O)([O-])OP([O-])(=O)O * common name: ** carboxyphosphat...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nitriles Nitriles] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] ==
 +
* smiles:
 +
** C(=O)([O-])OP([O-])(=O)O
 
* common name:
 
* common name:
** a nitrile
+
** carboxyphosphate
 +
* inchi key:
 +
** InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 139.989   
 
* Synonym(s):
 
* Synonym(s):
** nitrile
 
** R-CN
 
** a nitrile
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16910]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16909]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[3.5.5.1-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a nitrile}}
+
* PUBCHEM:
{{#set: common name=nitrile|R-CN|a nitrile}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826591 91826591]
{{#set: reversible reaction associated=3.5.5.1-RXN}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.169776.html 169776]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86994 86994]
 +
{{#set: smiles=C(=O)([O-])OP([O-])(=O)O}}
 +
{{#set: common name=carboxyphosphate}}
 +
{{#set: inchi key=InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L}}
 +
{{#set: molecular weight=139.989    }}
 +
{{#set: consumed by=RXN-16910}}
 +
{{#set: produced by=RXN-16909}}

Revision as of 16:43, 21 March 2018

Metabolite CPD-18238

  • smiles:
    • C(=O)([O-])OP([O-])(=O)O
  • common name:
    • carboxyphosphate
  • inchi key:
    • InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
  • molecular weight:
    • 139.989
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])OP([O-])(=O)O" cannot be used as a page name in this wiki.