Difference between revisions of "5-OXOPROLINASE-ATP-HYDROLYSING-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-VAL-tRNAs Charged-VAL-tRNAs] == * common name: ** an L-valyl-[tRNAval] * Synonym(s): =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * smiles: ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) * common...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == |
| + | * smiles: | ||
| + | ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) | ||
* common name: | * common name: | ||
| − | ** | + | ** L-dehydro-ascorbate |
| + | * inchi key: | ||
| + | ** InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N | ||
| + | * molecular weight: | ||
| + | ** 174.11 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** dehydroascorbate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12862]] | ||
| + | * [[RXN-12869]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-3523]] |
| + | * [[RXN-12440]] | ||
| + | * [[RXN-7984]] | ||
| + | * [[RXN-7985]] | ||
| + | * [[PEPTIDYLGLYCINE-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN-12876]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-13185]] | ||
| + | * [[RXN-13183]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: produced by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05422 C05422] |
| + | * HMDB : HMDB01264 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58070 58070] | ||
| + | * METABOLIGHTS : MTBLC58070 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15558810 15558810] | ||
| + | {{#set: smiles=C(O)C(O)C1(C(=O)C(=O)C(=O)O1)}} | ||
| + | {{#set: common name=L-dehydro-ascorbate}} | ||
| + | {{#set: inchi key=InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N}} | ||
| + | {{#set: molecular weight=174.11 }} | ||
| + | {{#set: common name=dehydroascorbate}} | ||
| + | {{#set: consumed by=RXN-12862|RXN-12869}} | ||
| + | {{#set: produced by=RXN-3523|RXN-12440|RXN-7984|RXN-7985|PEPTIDYLGLYCINE-MONOOXYGENASE-RXN|RXN-12876}} | ||
| + | {{#set: reversible reaction associated=RXN-13185|RXN-13183}} | ||
Revision as of 15:43, 21 March 2018
Contents
Metabolite L-DEHYDRO-ASCORBATE
- smiles:
- C(O)C(O)C1(C(=O)C(=O)C(=O)O1)
- common name:
- L-dehydro-ascorbate
- inchi key:
- InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N
- molecular weight:
- 174.11
- Synonym(s):
- dehydroascorbate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
