Difference between revisions of "Carboxylates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * i...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D19-31-3-oxo-C50-2-ACPs cis-cis-D19-31-3-oxo-C50-2-ACPs] == * common name: ** a cis,cis...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D19-31-3-oxo-C50-2-ACPs cis-cis-D19-31-3-oxo-C50-2-ACPs] ==
* smiles:
+
** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K
+
 
* common name:
 
* common name:
** cis-homoaconitate
+
** a cis,cis-delta19,31-3-oxo-C50:2-[acp]
* molecular weight:
+
** 185.113   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-carboxyhex-2-enedioate
 
** (Z)-but-1-ene-1,2,4-tricarboxylate
 
** homo-cis-aconitate
 
** (Z)-1,2,4-but-1-enetricarboxylic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-951]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[HOMOACONITATE-HYDRATASE-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis,cis-delta19,31-3-oxo-C50:2-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21158450 21158450]
+
{{#set: consumed by=RXN1G-951}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.20117984.html 20117984]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58174 58174]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04002 C04002]
+
{{#set: smiles=C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K}}
+
{{#set: common name=cis-homoaconitate}}
+
{{#set: molecular weight=185.113    }}
+
{{#set: common name=3-carboxyhex-2-enedioate|(Z)-but-1-ene-1,2,4-tricarboxylate|homo-cis-aconitate|(Z)-1,2,4-but-1-enetricarboxylic acid}}
+
{{#set: reversible reaction associated=HOMOACONITATE-HYDRATASE-RXN}}
+

Revision as of 15:43, 21 March 2018

Metabolite cis-cis-D19-31-3-oxo-C50-2-ACPs

  • common name:
    • a cis,cis-delta19,31-3-oxo-C50:2-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis,cis-delta19,31-3-oxo-C50:2-[acp" cannot be used as a page name in this wiki.