Difference between revisions of "3.2.1.58-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1588 == * left end position: ** 10009 * transcription direction: ** POSITIVE * right end position: ** 10692 * centisome position: ** 43.438...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] == * smiles: ** CC(C)C([N+])C([O-])=O * common name: ** L-valine * inchi key: ** InChI...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C([N+])C([O-])=O |
− | * | + | * common name: |
− | ** | + | ** L-valine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 117.147 |
* Synonym(s): | * Synonym(s): | ||
+ | ** V | ||
+ | ** val | ||
+ | ** valine | ||
+ | ** L-val | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[VALINE--TRNA-LIGASE-RXN]] |
− | + | * [[RME144]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | * [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]] |
− | + | ||
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 72-18-4 |
− | {{#set: | + | * BIGG : val__L |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971018 6971018] |
− | {{#set: | + | * HMDB : HMDB00883 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00183 C00183] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57762 57762] | ||
+ | * METABOLIGHTS : MTBLC57762 | ||
+ | {{#set: smiles=CC(C)C([N+])C([O-])=O}} | ||
+ | {{#set: common name=L-valine}} | ||
+ | {{#set: inchi key=InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N}} | ||
+ | {{#set: molecular weight=117.147 }} | ||
+ | {{#set: common name=V|val|valine|L-val}} | ||
+ | {{#set: consumed by=VALINE--TRNA-LIGASE-RXN|RME144}} | ||
+ | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERVAL-RXN}} |
Revision as of 15:45, 21 March 2018
Contents
Metabolite VAL
- smiles:
- CC(C)C([N+])C([O-])=O
- common name:
- L-valine
- inchi key:
- InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N
- molecular weight:
- 117.147
- Synonym(s):
- V
- val
- valine
- L-val
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 72-18-4
- BIGG : val__L
- PUBCHEM:
- HMDB : HMDB00883
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57762
"CC(C)C([N+])C([O-])=O" cannot be used as a page name in this wiki.