Difference between revisions of "P641-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** palmitoleic acid biosynthesis I |
+ | ** palmitoleate biosynthesis (anaerobic) | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''9''' reaction(s) found |
− | * [[ | + | ** [[RXN-10661]] |
− | + | ** [[RXN-10660]] | |
− | * [[ | + | ** [[RXN-10656]] |
− | * [[ | + | ** [[RXN-10657]] |
− | == Reaction(s) | + | ** [[RXN-10654]] |
+ | ** [[RXN-10655]] | ||
+ | ** [[RXN-9550]] | ||
+ | ** [[RXN-10658]] | ||
+ | ** [[RXN-10659]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''0''' reaction(s) not found | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6282 PWY-6282] | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | ** [http:// | + | {{#set: common name=palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate)}} |
− | + | {{#set: common name=palmitoleic acid biosynthesis I|palmitoleate biosynthesis (anaerobic)}} | |
− | + | {{#set: reaction found=9}} | |
− | + | {{#set: reaction not found=0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 15:36, 10 January 2018
Pathway PWY-6282
- taxonomic range:
- common name:
- palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate)
- Synonym(s):
- palmitoleic acid biosynthesis I
- palmitoleate biosynthesis (anaerobic)
Reaction(s) found
- 9 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found
External links
- ECOCYC: