Difference between revisions of "Tiso gene 3065"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROQUINATE DEHYDROQUINATE] == * smiles: ** C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.13-RXN 2.7.7.13-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.13-RXN 2.7.7.13-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.7.7.13 EC-2.7.7.13] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[MANNOSE-1P]][c] '''+''' 1 [[GTP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[GDP-MANNOSE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 α-D-mannose 1-phosphate[c] '''+''' 1 GTP[c] '''+''' 1 H+[c] '''=>''' 1 diphosphate[c] '''+''' 1 GDP-α-D-mannose[c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14704]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5659]], GDP-mannose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] | ||
+ | ** '''6''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15229 15229] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00885 R00885] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q9TRF4 Q9TRF4] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q59427 Q59427] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P41940 P41940] |
− | * | + | ** [http://www.uniprot.org/uniprot/O22287 O22287] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O74484 O74484] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.7.13}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_14704}} |
− | {{#set: | + | {{#set: in pathway=PWY-5659|PWY-882}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-synechocystis}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + |
Revision as of 15:46, 21 March 2018
Contents
Reaction 2.7.7.13-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MANNOSE-1P[c] + 1 GTP[c] + 1 PROTON[c] => 1 PPI[c] + 1 GDP-MANNOSE[c]
- With common name(s):
- 1 α-D-mannose 1-phosphate[c] + 1 GTP[c] + 1 H+[c] => 1 diphosphate[c] + 1 GDP-α-D-mannose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14704
- Source: orthology-synechocystis
Pathways
- PWY-5659, GDP-mannose biosynthesis: PWY-5659
- 3 reactions found over 4 reactions in the full pathway
- PWY-882, L-ascorbate biosynthesis I (L-galactose pathway): PWY-882
- 6 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
External links