Difference between revisions of "R05068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] == * smiles: ** CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DATCY DATCY] == * direction: ** LEFT-TO-RIGHT * common name: ** dATP:cytidine 5'-phosphotransferase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DATCY DATCY] ==
−
* smiles:
+
* direction:
−
** CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HZSAJDVWZRBGIF-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** thiamine phosphate
+
** dATP:cytidine 5'-phosphotransferase
−
* molecular weight:
+
−
** 343.317   
+
 
* Synonym(s):
 
* Synonym(s):
−
** TMP
 
−
** thiamin monophosphate
 
−
** thiamin phosphate
 
−
** thiamin-P
 
−
** thiamine-Pi
 
−
** ThP
 
−
** thiamine monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXNQT-4191]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[DATP]][c] '''+''' 1.0 [[CYTIDINE]][c] '''=>''' 1.0 [[DADP]][c] '''+''' 1.0 [[CMP]][c] '''+''' 1.0 [[PROTON]][c]
−
* [[THI-P-SYN-RXN]]
+
* With common name(s):
−
* [[RXN-12610]]
+
** 1.0 dATP[c] '''+''' 1.0 cytidine[c] '''=>''' 1.0 dADP[c] '''+''' 1.0 CMP[c] '''+''' 1.0 H+[c]
−
* [[RXN-12611]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[RXN0-3542]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 532-40-1
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC37575
+
{{#set: common name=dATP:cytidine 5'-phosphotransferase}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15942892 15942892]
+
{{#set: in pathway=}}
−
* HMDB : HMDB02666
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01081 C01081]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13085545.html 13085545]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37575 37575]
+
−
* BIGG : thmmp
+
−
{{#set: smiles=CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2))}}
+
−
{{#set: inchi key=InChIKey=HZSAJDVWZRBGIF-UHFFFAOYSA-M}}
+
−
{{#set: common name=thiamine phosphate}}
+
−
{{#set: molecular weight=343.317    }}
+
−
{{#set: common name=TMP|thiamin monophosphate|thiamin phosphate|thiamin-P|thiamine-Pi|ThP|thiamine monophosphate}}
+
−
{{#set: consumed by=RXNQT-4191}}
+
−
{{#set: produced by=THI-P-SYN-RXN|RXN-12610|RXN-12611}}
+
−
{{#set: reversible reaction associated=RXN0-3542}}
+

Revision as of 15:47, 21 March 2018

Reaction DATCY

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dATP:cytidine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 dATP[c] + 1.0 cytidine[c] => 1.0 dADP[c] + 1.0 CMP[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=R05068&oldid=36257"