Difference between revisions of "RXN-14264"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * smiles: ** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18207 RXN-18207] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18207 RXN-18207] ==
−
* smiles:
+
* direction:
−
** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L
+
−
* common name:
+
−
** FADH2
+
−
* molecular weight:
+
−
** 785.556   
+
 
* Synonym(s):
 
* Synonym(s):
−
** flavin adenine dinucleotide reduced
 
−
** 1,5-dihydro-FAD
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[G3PD3]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-19490]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPDQT-28]][c]
−
* [[MEPROPCOA-FAD-RXN]]
+
* With common name(s):
−
* [[ACOA120or]]
+
** 1 3-isopropyl-7-(methylthio)-2-oxoheptanoate[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 7-(methylthio)-2-oxoheptanoate[c]
−
* [[MCDH_2mb2coa]]
+
 
−
* [[ACOA140or]]
+
== Genes associated with this reaction  ==
−
* [[ACOA160or]]
+
== Pathways  ==
−
* [[ACOA80or]]
+
* [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450]
−
* [[MCDH]]
+
** '''10''' reactions found over '''30''' reactions in the full pathway
−
* [[IVCDH]]
+
== Reconstruction information  ==
−
* [[ACOA40or]]
+
* Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
−
* [[PPCOAOm]]
+
*** Tool: [[pathwaytools]]
−
* [[RXN-14264]]
+
−
* [[RXN-14193]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 1910-41-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC58307
+
{{#set: in pathway=PWYQT-4450}}
−
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931118 46931118]
+
{{#set: reconstruction source=annotation-experimental_annotation}}
−
* HMDB : HMDB01197
+
{{#set: reconstruction tool=pathwaytools}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01352 C01352]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58307 58307]
+
−
* BIGG : fadh2
+
−
{{#set: smiles=CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))}}
+
−
{{#set: inchi key=InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L}}
+
−
{{#set: common name=FADH2}}
+
−
{{#set: molecular weight=785.556    }}
+
−
{{#set: common name=flavin adenine dinucleotide reduced|1,5-dihydro-FAD}}
+
−
{{#set: consumed by=G3PD3}}
+
−
{{#set: produced by=MEPROPCOA-FAD-RXN|ACOA120or|MCDH_2mb2coa|ACOA140or|ACOA160or|ACOA80or|MCDH|IVCDH|ACOA40or}}
+
−
{{#set: reversible reaction associated=PPCOAOm|RXN-14264|RXN-14193}}
+

Revision as of 16:47, 21 March 2018

Reaction RXN-18207

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-isopropyl-7-(methylthio)-2-oxoheptanoate[c] + 1 H+[c] => 1 CO2[c] + 1 7-(methylthio)-2-oxoheptanoate[c]

Genes associated with this reaction

Pathways

  • PWYQT-4450, aliphatic glucosinolate biosynthesis, side chain elongation cycle: PWYQT-4450
    • 10 reactions found over 30 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14264&oldid=36308"