Difference between revisions of "Tiso gene 18788"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * inchi key: **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP-tRNAs TRP-tRNAs] == * common name: ** a tRNAtrp * Synonym(s): ** TRNA(TRP) == Reaction(s)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP-tRNAs TRP-tRNAs] ==
* smiles:
+
** C2(=C(C1(C=CC=CC=1N2))C(O)CO)
+
* inchi key:
+
** InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** indole-3-glycol
+
** a tRNAtrp
* molecular weight:
+
** 177.202   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** TRNA(TRP)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5424]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a tRNAtrp}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202910 25202910]
+
{{#set: common name=TRNA(TRP)}}
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)CO)}}
+
{{#set: consumed by=TRYPTOPHAN--TRNA-LIGASE-RXN}}
{{#set: inchi key=InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N}}
+
{{#set: common name=indole-3-glycol}}
+
{{#set: molecular weight=177.202    }}
+
{{#set: produced by=RXN-5424}}
+

Revision as of 15:48, 21 March 2018

Metabolite TRP-tRNAs

  • common name:
    • a tRNAtrp
  • Synonym(s):
    • TRNA(TRP)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links