Difference between revisions of "Beta-D-Galactosides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Polyphosphate Long-Chain-Polyphosphate] == * common name: ** long chain polyphosphat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] == |
+ | * smiles: | ||
+ | ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** 5-trans-3-oxo-dodecenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J | ||
+ | * molecular weight: | ||
+ | ** 957.775 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5E-3-oxo-dodecenoyl-CoA |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14803]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658857 90658857] |
− | {{#set: | + | {{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: common name=5-trans-3-oxo-dodecenoyl-CoA}} |
+ | {{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J}} | ||
+ | {{#set: molecular weight=957.775 }} | ||
+ | {{#set: common name=5E-3-oxo-dodecenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-14803}} |
Revision as of 16:48, 21 March 2018
Contents
Metabolite CPD-15691
- smiles:
- CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 5-trans-3-oxo-dodecenoyl-CoA
- inchi key:
- InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J
- molecular weight:
- 957.775
- Synonym(s):
- 5E-3-oxo-dodecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.