Difference between revisions of "Tiso gene 11756"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.47-RXN 3.2.1.47-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.47-RXN 3.2.1.47-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.2.1.47 EC-3.2.1.47] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[D-GALACTOSYL-14-D-GALACTOSYL-14-D-]][c] '''=>''' 1 [[D-galactopyranose]][c] '''+''' 1 [[Lactosyl-Ceramides]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H2O[c] '''+''' 1 a globotriosylceramide[c] '''=>''' 1 D-galactopyranose[c] '''+''' 1 a lactosylceramide[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_3392]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21115 21115] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.2.1.47}} | |
− | + | {{#set: gene associated=Tiso_gene_3392}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-athaliana}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: reconstruction tool=pantograph}} |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:49, 21 March 2018
Contents
Reaction 3.2.1.47-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 D-GALACTOSYL-14-D-GALACTOSYL-14-D-[c] => 1 D-galactopyranose[c] + 1 Lactosyl-Ceramides[c]
- With common name(s):
- 1 H2O[c] + 1 a globotriosylceramide[c] => 1 D-galactopyranose[c] + 1 a lactosylceramide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3392
- Source: orthology-athaliana
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana
External links
- RHEA: