Difference between revisions of "Tiso gene 16258"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11060 RXN-11060] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11060 RXN-11060] ==
−
* smiles:
+
* direction:
−
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
+
 
* common name:
 
* common name:
−
** isofucosterol
+
** exostosin_family_protein
−
* molecular weight:
+
* ec number:
−
** 412.698   
+
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-4210]]
+
** 1 [[UDP-GLUCURONATE]][c] '''+''' 1 [[N-ACETYL-SEROTONIN]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-12016]][c] '''+''' 1 [[UDP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 UDP-α-D-glucuronate[c] '''+''' 1 N-acetyl-serotonin[c] '''=>''' 1 H+[c] '''+''' 1 N-acetyl-serotonin glucuronide[c] '''+''' 1 UDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14141]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14140]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6398]], melatonin degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281326 5281326]
+
{{#set: common name=exostosin_family_protein}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.4.1.17}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
+
{{#set: gene associated=Tiso_gene_14141|Tiso_gene_14140}}
−
* HMDB : HMDB02374
+
{{#set: in pathway=PWY-6398}}
−
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: common name=isofucosterol}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=412.698    }}
+
−
{{#set: produced by=RXN-4210}}
+

Revision as of 15:49, 21 March 2018

Reaction RXN-11060

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • exostosin_family_protein
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6398, melatonin degradation I: PWY-6398
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16258&oldid=36519"