Difference between revisions of "3-OXOPIMELOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * smiles: ** CC(O)(C(=O)[O-])CC(=O)[O-] * common name: ** (R)-citramalate * i...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(O)(C(=O)[O-])CC(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (R)-citramalate |
+ | * inchi key: | ||
+ | ** InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 146.099 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (R)-2-methylmalic acid |
− | ** | + | ** (3R)-citramalate |
+ | ** (3R)-citramalic acid | ||
+ | ** (3R)-α-hydroxypyrotartaric acid | ||
+ | ** D-citramalate | ||
+ | ** D-citramalic acid | ||
+ | ** D-α-hydroxypyrotartaric acid | ||
+ | ** (R)-2-methylmalate | ||
+ | ** (R)-(-)-citramalic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7743]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 6236-10-8 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460281 5460281] |
− | * | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.4573870.html 4573870] | |
− | ** [http://www. | + | |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30934 30934] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02612 C02612] |
− | {{#set: | + | {{#set: smiles=CC(O)(C(=O)[O-])CC(=O)[O-]}} |
− | {{#set: | + | {{#set: common name=(R)-citramalate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L}} |
− | {{#set: common name= | + | {{#set: molecular weight=146.099 }} |
− | + | {{#set: common name=(R)-2-methylmalic acid|(3R)-citramalate|(3R)-citramalic acid|(3R)-α-hydroxypyrotartaric acid|D-citramalate|D-citramalic acid|D-α-hydroxypyrotartaric acid|(R)-2-methylmalate|(R)-(-)-citramalic acid}} | |
− | {{#set: produced by= | + | {{#set: produced by=RXN-7743}} |
Revision as of 15:49, 21 March 2018
Contents
Metabolite CPD-31
- smiles:
- CC(O)(C(=O)[O-])CC(=O)[O-]
- common name:
- (R)-citramalate
- inchi key:
- InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L
- molecular weight:
- 146.099
- Synonym(s):
- (R)-2-methylmalic acid
- (3R)-citramalate
- (3R)-citramalic acid
- (3R)-α-hydroxypyrotartaric acid
- D-citramalate
- D-citramalic acid
- D-α-hydroxypyrotartaric acid
- (R)-2-methylmalate
- (R)-(-)-citramalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)(C(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.