Difference between revisions of "CPD1G-768"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] == * common name: ** a 5...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] ==
* smiles:
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
+
 
* common name:
 
* common name:
** 6-oxocampestanol
+
** a 5-methylaminomethyl-2-thiouridine in tRNA
* molecular weight:
+
** 416.686   
+
 
* Synonym(s):
 
* Synonym(s):
** oxocampestanol
+
** a 5-methylaminomethyl-2-thiouridylate in tRNA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-715]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5144]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 5-methylaminomethyl-2-thiouridine in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061347 16061347]
+
{{#set: common name=a 5-methylaminomethyl-2-thiouridylate in tRNA}}
* CHEBI:
+
{{#set: produced by=RXN0-5144}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20747 20747]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789]
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}}
+
{{#set: common name=6-oxocampestanol}}
+
{{#set: molecular weight=416.686    }}
+
{{#set: common name=oxocampestanol}}
+
{{#set: consumed by=RXN-715}}
+

Revision as of 15:49, 21 March 2018

Metabolite tRNA-Containing-5MeAminoMe-2-ThioU

  • common name:
    • a 5-methylaminomethyl-2-thiouridine in tRNA
  • Synonym(s):
    • a 5-methylaminomethyl-2-thiouridylate in tRNA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links