Difference between revisions of "CPD-13377"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=SECPZKHBE...") |
(Created page with "Category:Gene == Gene Tiso_gene_8464 == * right end position: ** 6072 * transcription direction: ** POSITIVE * left end position: ** 4504 * centisome position: ** 32.78736...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_8464 == |
| − | * | + | * right end position: |
| − | ** | + | ** 6072 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 4504 |
| − | * | + | * centisome position: |
| − | ** | + | ** 32.78736 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[HISTONE-ACETYLTRANSFERASE-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | * [[ | + | *** Assignment: automated-name-match |
| − | == | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: right end position=6072}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=4504}} | |
| − | + | {{#set: centisome position=32.78736 }} | |
| − | + | {{#set: reaction associated=HISTONE-ACETYLTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 15:50, 21 March 2018
Gene Tiso_gene_8464
- right end position:
- 6072
- transcription direction:
- POSITIVE
- left end position:
- 4504
- centisome position:
- 32.78736
- Synonym(s):
Reactions associated
- Reaction: HISTONE-ACETYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
