Difference between revisions of "Tiso gene 19293"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1602 RXN-1602] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1602 RXN-1602] ==
−
* smiles:
+
* direction:
−
** C(C(=O)[O-])C(O)[CH]=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
+
** [http://enzyme.expasy.org/EC/3.1.1.34 EC-3.1.1.34]
−
* common name:
+
** [http://enzyme.expasy.org/EC/3.1.1.79 EC-3.1.1.79]
−
** L-malic semialdehyde
+
−
* molecular weight:
+
−
** 117.081   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-3-hydroxy-4-oxobutanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-6002]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[1-2-Diglycerides]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Fatty-Acids]][c] '''+''' 1 [[CPD-409]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 a 1,2-diglyceride[c] '''=>''' 1 H+[c] '''+''' 1 a fatty acid[c] '''+''' 1 a 2-acylglycerol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[LIPAS-PWY]], triacylglycerol degradation: [http://metacyc.org/META/NEW-IMAGE?object=LIPAS-PWY LIPAS-PWY]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18761 18761]
−
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R05209 R05209]
−
{{#set: common name=L-malic semialdehyde}}
+
* UNIPROT:
−
{{#set: molecular weight=117.081    }}
+
** [http://www.uniprot.org/uniprot/P11153 P11153]
−
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+
** [http://www.uniprot.org/uniprot/P11152 P11152]
−
{{#set: consumed by=RXN-6002}}
+
** [http://www.uniprot.org/uniprot/Q06000 Q06000]
 +
** [http://www.uniprot.org/uniprot/P06858 P06858]
 +
** [http://www.uniprot.org/uniprot/P11602 P11602]
 +
** [http://www.uniprot.org/uniprot/P49923 P49923]
 +
** [http://www.uniprot.org/uniprot/Q29524 Q29524]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: ec number=EC-3.1.1.34}}
 +
{{#set: ec number=EC-3.1.1.79}}
 +
{{#set: in pathway=LIPAS-PWY}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 15:50, 21 March 2018

Reaction RXN-1602

Reaction Formula

Genes associated with this reaction

Pathways

  • LIPAS-PWY, triacylglycerol degradation: LIPAS-PWY
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19293&oldid=36635"