Difference between revisions of "2-phospho-ligated-tRNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10411 CPD-10411] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C(CC(O)2)=C(O)C=C(O)C=3))) * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_20384 == * right end position: ** 1321 * transcription direction: ** POSITIVE * left end position: ** 24 * centisome position: ** 1.690141...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_20384 == |
− | * | + | * right end position: |
− | ** | + | ** 1321 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 24 |
− | * | + | * centisome position: |
− | ** | + | ** 1.690141 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[M5TAP]] | |
− | * [[RXN- | + | ** Source: [[orthology-creinhardtii]] |
− | == | + | * Reaction: [[URA-PHOSPH-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[URPHOS-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5532]] | ||
+ | * [[PWY0-1295]] | ||
+ | * [[PWY-7181]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1321}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=24}} | |
− | + | {{#set: centisome position=1.690141 }} | |
− | + | {{#set: reaction associated=M5TAP|URA-PHOSPH-RXN|URPHOS-RXN}} | |
− | + | {{#set: pathway associated=PWY-5532|PWY0-1295|PWY-7181}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:50, 21 March 2018
Gene Tiso_gene_20384
- right end position:
- 1321
- transcription direction:
- POSITIVE
- left end position:
- 24
- centisome position:
- 1.690141
- Synonym(s):
Reactions associated
- Reaction: M5TAP
- Source: orthology-creinhardtii
- Reaction: URA-PHOSPH-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: URPHOS-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation