Difference between revisions of "CPDQT-29"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_6311 == * Synonym(s): == Reactions associated == * Reaction: 3.6.1.41-RXN ** Source: orthology-creinhardtii == Pathways associated...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_6311 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN | + | * Reaction: [[3.6.1.41-RXN]] |
| − | + | ** Source: [[orthology-creinhardtii]] | |
| − | * [[ | + | == Pathways associated == |
| − | == | + | |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=3.6.1.41-RXN}} | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 15:51, 21 March 2018
Gene Tiso_gene_6311
- Synonym(s):
Reactions associated
- Reaction: 3.6.1.41-RXN
- Source: orthology-creinhardtii
