Difference between revisions of "RXN-8026"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_5199 == * right end position: ** 13641 * transcription direction: ** POSITIVE * left end position: ** 10190 * centisome position: ** 73.867...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5199 == |
− | * | + | * right end position: |
− | ** | + | ** 13641 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 10190 |
− | * | + | * centisome position: |
− | ** | + | ** 73.86735 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=13641}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=10190}} | |
− | + | {{#set: centisome position=73.86735 }} | |
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 16:51, 21 March 2018
Gene Tiso_gene_5199
- right end position:
- 13641
- transcription direction:
- POSITIVE
- left end position:
- 10190
- centisome position:
- 73.86735
- Synonym(s):
Reactions associated
- Reaction: NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation