Difference between revisions of "Tiso gene 5199"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5199 == * left end position: ** 10190 * transcription direction: ** POSITIVE * right end position: ** 13641 * centisome position: ** 73.867...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_5199 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
−
* left end position:
+
* smiles:
−
** 10190
+
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** triiodothyroacetate ether glucuronide
−
* right end position:
+
* inchi key:
−
** 13641
+
** InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
−
* centisome position:
+
* molecular weight:
−
** 73.86735    
+
** 796.046    
 
* Synonym(s):
 
* Synonym(s):
 +
** triiodothyroacetic acid ether glucuronide
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-10619]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=10190}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659025 90659025]
−
{{#set: right end position=13641}}
+
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))}}
−
{{#set: centisome position=73.86735   }}
+
{{#set: common name=triiodothyroacetate ether glucuronide}}
−
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
+
{{#set: inchi key=InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L}}
 +
{{#set: molecular weight=796.046   }}
 +
{{#set: common name=triiodothyroacetic acid ether glucuronide}}
 +
{{#set: produced by=RXN-10619}}

Revision as of 15:51, 21 March 2018

Metabolite CPD-11410

  • smiles:
    • C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
  • common name:
    • triiodothyroacetate ether glucuronide
  • inchi key:
    • InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
  • molecular weight:
    • 796.046
  • Synonym(s):
    • triiodothyroacetic acid ether glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5199&oldid=36779"