Difference between revisions of "RXN0-5098"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ANTHRANILATE 3-HYDROXY-ANTHRANILATE] == * smiles: ** C1(C=C(C(N)=C(O)C=1)C([O-])=O) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5098 RXN0-5098] == * direction: ** LEFT-TO-RIGHT * common name: ** lipoate-protein_ligase_a **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5098 RXN0-5098] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** lipoate-protein_ligase_a |
− | * | + | ** lipoate-protein_ligase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/6.3.1.20 EC-6.3.1.20] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[1 | + | * With identifiers: |
− | = | + | ** 1 [[Lipoyl-Protein-L-Lysine]][c] '''+''' 1 [[CPD-195]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[Octanoylated-domains]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PPI]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 a [lipoyl-carrier protein]-L-lysine[c] '''+''' 1 octanoate[c] '''+''' 1 ATP[c] '''=>''' 1 a [lipoyl-carrier protein] N6-octanoyl-L-lysine[c] '''+''' 1 AMP[c] '''+''' 1 H+[c] '''+''' 1 diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_4494]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_8713]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_17216]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_17215]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_4493]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY0-1275]], lipoate biosynthesis and incorporation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1275 PWY0-1275] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=lipoate-protein_ligase_a}} | |
− | + | {{#set: common name=lipoate-protein_ligase}} | |
− | + | {{#set: ec number=EC-6.3.1.20}} | |
− | + | {{#set: gene associated=Tiso_gene_4494|Tiso_gene_8713|Tiso_gene_17216|Tiso_gene_17215|Tiso_gene_4493}} | |
− | + | {{#set: in pathway=PWY0-1275}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:52, 21 March 2018
Contents
Reaction RXN0-5098
- direction:
- LEFT-TO-RIGHT
- common name:
- lipoate-protein_ligase_a
- lipoate-protein_ligase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Lipoyl-Protein-L-Lysine[c] + 1 CPD-195[c] + 1 ATP[c] => 1 Octanoylated-domains[c] + 1 AMP[c] + 1 PROTON[c] + 1 PPI[c]
- With common name(s):
- 1 a [lipoyl-carrier protein]-L-lysine[c] + 1 octanoate[c] + 1 ATP[c] => 1 a [lipoyl-carrier protein] N6-octanoyl-L-lysine[c] + 1 AMP[c] + 1 H+[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_4494
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8713
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17216
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17215
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4493
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY0-1275, lipoate biosynthesis and incorporation II: PWY0-1275
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation